C20H18ClFN2O5S — CID 55597520
(2-chloro-4-cyano-6-ethoxyphenyl) 4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 55597520) has the molecular formula C20H18ClFN2O5S and a molecular weight of 452.89 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55597520 |
| Molecular Formula | C20H18ClFN2O5S |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)c1ccc(F)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H18ClFN2O5S/c1-2-28-17-10-13(12-23)9-15(21)19(17)29-20(25)14-5-6-16(22)18(11-14)30(26,27)24-7-3-4-8-24/h5-6,9-11H,2-4,7-8H2,1H3 |
| InChIKey | UVAGCRWYAICQJU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|