C18H16ClNO5 — CID 8624290
(2-chloro-4-cyano-6-ethoxyphenyl) 3,5-dimethoxybenzoate (PubChem CID 8624290) has the molecular formula C18H16ClNO5 and a molecular weight of 361.78 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 3,5-dimethoxybenzoate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 8624290 |
| Molecular Formula | C18H16ClNO5 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 3,5-dimethoxybenzoate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H16ClNO5/c1-4-24-16-6-11(10-20)5-15(19)17(16)25-18(21)12-7-13(22-2)9-14(8-12)23-3/h5-9H,4H2,1-3H3 |
| InChIKey | ATZJICRKTBTDFQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|