C20H17ClN4O3 — CID 55669197
(2-chloro-4-cyano-6-ethoxyphenyl) 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (PubChem CID 55669197) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55669197 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)c1ccc(-n2nc(C)cc2C)nc1 |
| InChI | InChI=1S/C20H17ClN4O3/c1-4-27-17-9-14(10-22)8-16(21)19(17)28-20(26)15-5-6-18(23-11-15)25-13(3)7-12(2)24-25/h5-9,11H,4H2,1-3H3 |
| InChIKey | FMXOIUMSFXTMTN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|