C19H18ClNO4 — CID 30870537
(2-chloro-4-cyano-6-ethoxyphenyl) 2-(2,6-dimethylphenoxy)acetate (PubChem CID 30870537) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 2-(2,6-dimethylphenoxy)acetate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 2-(2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 30870537 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 2-(2,6-dimethylphenoxy)acetate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C19H18ClNO4/c1-4-23-16-9-14(10-21)8-15(20)19(16)25-17(22)11-24-18-12(2)6-5-7-13(18)3/h5-9H,4,11H2,1-3H3 |
| InChIKey | LVGDQZFPJIGWRN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|