C17H12ClNO5 — CID 55966784
(2-chloro-4-cyano-6-ethoxyphenyl) 1,3-benzodioxole-4-carboxylate (PubChem CID 55966784) has the molecular formula C17H12ClNO5 and a molecular weight of 345.74 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 1,3-benzodioxole-4-carboxylate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 55966784 |
| Molecular Formula | C17H12ClNO5 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 1,3-benzodioxole-4-carboxylate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)c1cccc2c1OCO2 |
| InChI | InChI=1S/C17H12ClNO5/c1-2-21-14-7-10(8-19)6-12(18)16(14)24-17(20)11-4-3-5-13-15(11)23-9-22-13/h3-7H,2,9H2,1H3 |
| InChIKey | MOLGHXVQNBDKGT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|