C20H20ClNO6 — CID 8624286
(2-chloro-4-cyano-6-ethoxyphenyl) 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 8624286) has the molecular formula C20H20ClNO6 and a molecular weight of 405.83 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 8624286 |
| Molecular Formula | C20H20ClNO6 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H20ClNO6/c1-5-27-17-9-13(11-22)6-14(21)19(17)28-18(23)10-12-7-15(24-2)20(26-4)16(8-12)25-3/h6-9H,5,10H2,1-4H3 |
| InChIKey | CTSPJDCYZUBRES-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|