C18H25NO6S — CID 46638412
(2-oxo-2-propan-2-yloxyethyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 46638412) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 46638412 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)OC(C)C)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H25NO6S/c1-13(2)25-17(20)12-24-18(21)15-8-7-14(3)16(11-15)26(22,23)19-9-5-4-6-10-19/h7-8,11,13H,4-6,9-10,12H2,1-3H3 |
| InChIKey | OQQGEFBYPLPIJL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |