C18H26N2O6S — CID 7824861
[2-(2-methoxyethylamino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 7824861) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7824861 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | COCCNC(=O)COC(=O)c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H26N2O6S/c1-14-6-7-15(18(22)26-13-17(21)19-8-11-25-2)12-16(14)27(23,24)20-9-4-3-5-10-20/h6-7,12H,3-5,8-11,13H2,1-2H3,(H,19,21) |
| InChIKey | BMFNFNIXOBCZOR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|