C23H28N2O5S — CID 2568523
[2-(N-ethylanilino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2568523) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is [2-(N-ethylanilino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(N-ethylanilino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2568523 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [2-(N-ethylanilino)-2-oxoethyl] 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CCN(C(=O)COC(=O)c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O5S/c1-3-25(20-10-6-4-7-11-20)22(26)17-30-23(27)19-13-12-18(2)21(16-19)31(28,29)24-14-8-5-9-15-24/h4,6-7,10-13,16H,3,5,8-9,14-15,17H2,1-2H3 |
| InChIKey | NBWHTFWZOOTIBF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |