C27H30N2O5S — CID 2545199
[2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 2545199) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2545199 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | CCN(C(=O)COC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H30N2O5S/c1-2-29(25-16-10-12-21-11-5-6-15-24(21)25)26(30)20-34-27(31)22-13-9-14-23(19-22)35(32,33)28-17-7-3-4-8-18-28/h5-6,9-16,19H,2-4,7-8,17-18,20H2,1H3 |
| InChIKey | DHZURZZMTCWIPV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |