C19H25N3O5S — CID 9081402
[2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 9081402) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 9081402 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CN(C(=O)COC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)C(C)(C)C#N |
| InChI | InChI=1S/C19H25N3O5S/c1-19(2,14-20)21(3)17(23)13-27-18(24)15-8-7-9-16(12-15)28(25,26)22-10-5-4-6-11-22/h7-9,12H,4-6,10-11,13H2,1-3H3 |
| InChIKey | OGIXSLKVVFYINO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |