C20H27N3O5S — CID 7981420
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 7981420) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7981420 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H27N3O5S/c1-15(2)20(3,14-21)22-18(24)13-28-19(25)16-8-7-9-17(12-16)29(26,27)23-10-5-4-6-11-23/h7-9,12,15H,4-6,10-11,13H2,1-3H3,(H,22,24)/t20-/m0/s1 |
| InChIKey | KNXJLDODALCPJZ-FQEVSTJZSA-N |
| XLogP | 2.07 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |