C23H28N2O5S — CID 2545042
[2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 2545042) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2545042 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C23H28N2O5S/c1-18-9-11-19(12-10-18)16-24-22(26)17-30-23(27)20-7-6-8-21(15-20)31(28,29)25-13-4-2-3-5-14-25/h6-12,15H,2-5,13-14,16-17H2,1H3,(H,24,26) |
| InChIKey | CHUYAEXWJVDDKF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |