C18H24ClNO6S — CID 24530164
(2-oxo-2-propan-2-yloxyethyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 24530164) has the molecular formula C18H24ClNO6S and a molecular weight of 417.91 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 24530164 |
| Molecular Formula | C18H24ClNO6S |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCN(S(=O)(=O)c2cc(C(=O)OCC(=O)OC(C)C)ccc2Cl)C1 |
| InChI | InChI=1S/C18H24ClNO6S/c1-12(2)26-17(21)11-25-18(22)14-6-7-15(19)16(9-14)27(23,24)20-8-4-5-13(3)10-20/h6-7,9,12-13H,4-5,8,10-11H2,1-3H3 |
| InChIKey | BMVGZAVNVVZIMV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |