C21H21ClN2O4S — CID 16504086
(4-cyanophenyl)methyl 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 16504086) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (4-cyanophenyl)methyl 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16504086 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (4-cyanophenyl)methyl 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCN(S(=O)(=O)c2cc(C(=O)OCc3ccc(C#N)cc3)ccc2Cl)C1 |
| InChI | InChI=1S/C21H21ClN2O4S/c1-15-3-2-10-24(13-15)29(26,27)20-11-18(8-9-19(20)22)21(25)28-14-17-6-4-16(12-23)5-7-17/h4-9,11,15H,2-3,10,13-14H2,1H3 |
| InChIKey | NRGULXROARNRSL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |