C19H27ClN2O5S — CID 16504066
[2-(tert-butylamino)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 16504066) has the molecular formula C19H27ClN2O5S and a molecular weight of 430.95 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16504066 |
| Molecular Formula | C19H27ClN2O5S |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCN(S(=O)(=O)c2cc(C(=O)OCC(=O)NC(C)(C)C)ccc2Cl)C1 |
| InChI | InChI=1S/C19H27ClN2O5S/c1-13-6-5-9-22(11-13)28(25,26)16-10-14(7-8-15(16)20)18(24)27-12-17(23)21-19(2,3)4/h7-8,10,13H,5-6,9,11-12H2,1-4H3,(H,21,23) |
| InChIKey | ALHXAUWGZXHEQB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |