C18H23N3O5S2 — CID 55527745
N'-(2,5-dimethylfuran-3-carbonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carbohydrazide (PubChem CID 55527745) has the molecular formula C18H23N3O5S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55527745 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)C2CCCN(S(=O)(=O)c3ccc(C)s3)C2)c(C)o1 |
| InChI | InChI=1S/C18H23N3O5S2/c1-11-9-15(13(3)26-11)18(23)20-19-17(22)14-5-4-8-21(10-14)28(24,25)16-7-6-12(2)27-16/h6-7,9,14H,4-5,8,10H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | AYSRMWHYYMKUCY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|