C23H22N2O5S2 — CID 1322539
(3-benzamidophenyl) 4-piperidin-1-ylsulfonylthiophene-2-carboxylate (PubChem CID 1322539) has the molecular formula C23H22N2O5S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is (3-benzamidophenyl) 4-piperidin-1-ylsulfonylthiophene-2-carboxylate.
| Compound Name | (3-benzamidophenyl) 4-piperidin-1-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 1322539 |
| Molecular Formula | C23H22N2O5S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (3-benzamidophenyl) 4-piperidin-1-ylsulfonylthiophene-2-carboxylate |
| SMILES | O=C(Nc1cccc(OC(=O)c2cc(S(=O)(=O)N3CCCCC3)cs2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O5S2/c26-22(17-8-3-1-4-9-17)24-18-10-7-11-19(14-18)30-23(27)21-15-20(16-31-21)32(28,29)25-12-5-2-6-13-25/h1,3-4,7-11,14-16H,2,5-6,12-13H2,(H,24,26) |
| InChIKey | YJFZJFAFADYJNX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|