C10H12N2O6S2 — CID 83101664
4-(3-carbamoylmorpholin-4-yl)sulfonylthiophene-2-carboxylic acid (PubChem CID 83101664) has the molecular formula C10H12N2O6S2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 4-(3-carbamoylmorpholin-4-yl)sulfonylthiophene-2-carboxylic acid.
| Compound Name | 4-(3-carbamoylmorpholin-4-yl)sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 83101664 |
| Molecular Formula | C10H12N2O6S2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 4-(3-carbamoylmorpholin-4-yl)sulfonylthiophene-2-carboxylic acid |
| SMILES | NC(=O)C1COCCN1S(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C10H12N2O6S2/c11-9(13)7-4-18-2-1-12(7)20(16,17)6-3-8(10(14)15)19-5-6/h3,5,7H,1-2,4H2,(H2,11,13)(H,14,15) |
| InChIKey | UOZHPJLATAJDJZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |