C11H11BrF2N2O4S — CID 83098970
4-(2-bromo-4,6-difluorophenyl)sulfonylmorpholine-3-carboxamide (PubChem CID 83098970) has the molecular formula C11H11BrF2N2O4S and a molecular weight of 385.19 g/mol. Its IUPAC name is 4-(2-bromo-4,6-difluorophenyl)sulfonylmorpholine-3-carboxamide.
| Compound Name | 4-(2-bromo-4,6-difluorophenyl)sulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098970 |
| Molecular Formula | C11H11BrF2N2O4S |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 4-(2-bromo-4,6-difluorophenyl)sulfonylmorpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1S(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H11BrF2N2O4S/c12-7-3-6(13)4-8(14)10(7)21(18,19)16-1-2-20-5-9(16)11(15)17/h3-4,9H,1-2,5H2,(H2,15,17) |
| InChIKey | CTEOBRYSAUOWJM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |