C12H14BrF2NO2S — CID 54917710
1-(2-bromo-4,6-difluorophenyl)sulfonyl-2-methylpiperidine (PubChem CID 54917710) has the molecular formula C12H14BrF2NO2S and a molecular weight of 354.22 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)sulfonyl-2-methylpiperidine.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)sulfonyl-2-methylpiperidine |
|---|---|
| PubChem CID | 54917710 |
| Molecular Formula | C12H14BrF2NO2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)sulfonyl-2-methylpiperidine |
| SMILES | CC1CCCCN1S(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H14BrF2NO2S/c1-8-4-2-3-5-16(8)19(17,18)12-10(13)6-9(14)7-11(12)15/h6-8H,2-5H2,1H3 |
| InChIKey | JCIMZMCCXUPRDN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |