C12H16Br2N2O2S — CID 43256908
3,5-dibromo-2-(2-methylpiperidin-1-yl)sulfonylaniline (PubChem CID 43256908) has the molecular formula C12H16Br2N2O2S and a molecular weight of 412.15 g/mol. Its IUPAC name is 3,5-dibromo-2-(2-methylpiperidin-1-yl)sulfonylaniline.
| Compound Name | 3,5-dibromo-2-(2-methylpiperidin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 43256908 |
| Molecular Formula | C12H16Br2N2O2S |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | 3,5-dibromo-2-(2-methylpiperidin-1-yl)sulfonylaniline |
| SMILES | CC1CCCCN1S(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O2S/c1-8-4-2-3-5-16(8)19(17,18)12-10(14)6-9(13)7-11(12)15/h6-8H,2-5,15H2,1H3 |
| InChIKey | XHKJSHPCVZSDHM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|