C10H12Br2N2O2S — CID 43256817
3,5-dibromo-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 43256817) has the molecular formula C10H12Br2N2O2S and a molecular weight of 384.09 g/mol. Its IUPAC name is 3,5-dibromo-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | 3,5-dibromo-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 43256817 |
| Molecular Formula | C10H12Br2N2O2S |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | 3,5-dibromo-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | Nc1cc(Br)cc(Br)c1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C10H12Br2N2O2S/c11-7-5-8(12)10(9(13)6-7)17(15,16)14-3-1-2-4-14/h5-6H,1-4,13H2 |
| InChIKey | BLGXGGJOQMMSFA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|