C12H15Br2N3O3S — CID 63602712
4-(2-amino-4,6-dibromophenyl)sulfonyl-3-ethylpiperazin-2-one (PubChem CID 63602712) has the molecular formula C12H15Br2N3O3S and a molecular weight of 441.15 g/mol. Its IUPAC name is 4-(2-amino-4,6-dibromophenyl)sulfonyl-3-ethylpiperazin-2-one.
| Compound Name | 4-(2-amino-4,6-dibromophenyl)sulfonyl-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 63602712 |
| Molecular Formula | C12H15Br2N3O3S |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | 4-(2-amino-4,6-dibromophenyl)sulfonyl-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1S(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C12H15Br2N3O3S/c1-2-10-12(18)16-3-4-17(10)21(19,20)11-8(14)5-7(13)6-9(11)15/h5-6,10H,2-4,15H2,1H3,(H,16,18) |
| InChIKey | AVLKCWXSPFAYOO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|