C12H16Br2N2O3S — CID 107213586
2-amino-4,6-dibromo-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 107213586) has the molecular formula C12H16Br2N2O3S and a molecular weight of 428.15 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107213586 |
| Molecular Formula | C12H16Br2N2O3S |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | 2-amino-4,6-dibromo-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | Nc1cc(Br)cc(Br)c1S(=O)(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H16Br2N2O3S/c13-7-5-8(14)12(9(15)6-7)20(18,19)16-10-3-1-2-4-11(10)17/h5-6,10-11,16-17H,1-4,15H2/t10-,11-/m1/s1 |
| InChIKey | VRDAAYUGYVTLLT-GHMZBOCLSA-N |
| XLogP | 2.38 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|