C13H19ClN2O3S — CID 107213615
5-amino-2-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 107213615) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107213615 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 5-amino-2-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(S(=O)(=O)N[C@@H]2CCCC[C@H]2O)cc1N |
| InChI | InChI=1S/C13H19ClN2O3S/c1-8-6-9(14)13(7-10(8)15)20(18,19)16-11-4-2-3-5-12(11)17/h6-7,11-12,16-17H,2-5,15H2,1H3/t11-,12-/m1/s1 |
| InChIKey | GAKBMGWUMHHWSW-VXGBXAGGSA-N |
| XLogP | 1.81 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|