C15H22FNO2S — CID 107327191
1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-methylazepane (PubChem CID 107327191) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-methylazepane.
| Compound Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-methylazepane |
|---|---|
| PubChem CID | 107327191 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2-methylazepane |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCCCCC1C |
| InChI | InChI=1S/C15H22FNO2S/c1-11-9-14(16)10-12(2)15(11)20(18,19)17-8-6-4-5-7-13(17)3/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | UEHCGBFBDHEKNQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |