C15H20FNO3S — CID 107327036
4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 107327036) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 107327036 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCOC2CCCC21 |
| InChI | InChI=1S/C15H20FNO3S/c1-10-8-12(16)9-11(2)15(10)21(18,19)17-6-7-20-14-5-3-4-13(14)17/h8-9,13-14H,3-7H2,1-2H3 |
| InChIKey | GVKBSCLAARYKKN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |