C13H16FNO5S2 — CID 110290112
4-(4-fluoro-2-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 110290112) has the molecular formula C13H16FNO5S2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-(4-fluoro-2-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 4-(4-fluoro-2-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 110290112 |
| Molecular Formula | C13H16FNO5S2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-(4-fluoro-2-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C13H16FNO5S2/c1-9-6-10(14)2-3-13(9)22(18,19)15-4-5-20-12-8-21(16,17)7-11(12)15/h2-3,6,11-12H,4-5,7-8H2,1H3 |
| InChIKey | GTQUZVVWCYUACV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |