C12H14ClNO5S2 — CID 110290101
4-(4-chlorophenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 110290101) has the molecular formula C12H14ClNO5S2 and a molecular weight of 351.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 110290101 |
| Molecular Formula | C12H14ClNO5S2 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | O=S1(=O)CC2OCCN(S(=O)(=O)c3ccc(Cl)cc3)C2C1 |
| InChI | InChI=1S/C12H14ClNO5S2/c13-9-1-3-10(4-2-9)21(17,18)14-5-6-19-12-8-20(15,16)7-11(12)14/h1-4,11-12H,5-8H2 |
| InChIKey | QSXOZTRNEMXKJG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |