C13H13Cl2NO4S — CID 110290081
(2,4-dichlorophenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone (PubChem CID 110290081) has the molecular formula C13H13Cl2NO4S and a molecular weight of 350.22 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone |
|---|---|
| PubChem CID | 110290081 |
| Molecular Formula | C13H13Cl2NO4S |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (2,4-dichlorophenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C13H13Cl2NO4S/c14-8-1-2-9(10(15)5-8)13(17)16-3-4-20-12-7-21(18,19)6-11(12)16/h1-2,5,11-12H,3-4,6-7H2 |
| InChIKey | CRNNWGRAKLIUAP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |