C15H19NO5S — CID 110290051
1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-phenoxypropan-1-one (PubChem CID 110290051) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-phenoxypropan-1-one.
| Compound Name | 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-phenoxypropan-1-one |
|---|---|
| PubChem CID | 110290051 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-phenoxypropan-1-one |
| SMILES | O=C(CCOc1ccccc1)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C15H19NO5S/c17-15(6-8-20-12-4-2-1-3-5-12)16-7-9-21-14-11-22(18,19)10-13(14)16/h1-5,13-14H,6-11H2 |
| InChIKey | RRRDBUKUBRPBHX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |