C17H19N3O5S — CID 110629035
1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanone (PubChem CID 110629035) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanone.
| Compound Name | 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 110629035 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanone |
| SMILES | Cc1ccccc1-c1noc(CC(=O)N2CCOC3CS(=O)(=O)CC32)n1 |
| InChI | InChI=1S/C17H19N3O5S/c1-11-4-2-3-5-12(11)17-18-15(25-19-17)8-16(21)20-6-7-24-14-10-26(22,23)9-13(14)20/h2-5,13-14H,6-10H2,1H3 |
| InChIKey | RYYCBBKUHAVFGI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |