C13H14FNO4S — CID 110290024
(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-(3-fluorophenyl)methanone (PubChem CID 110290024) has the molecular formula C13H14FNO4S and a molecular weight of 299.32 g/mol. Its IUPAC name is (6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-(3-fluorophenyl)methanone.
| Compound Name | (6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 110290024 |
| Molecular Formula | C13H14FNO4S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C13H14FNO4S/c14-10-3-1-2-9(6-10)13(16)15-4-5-19-12-8-20(17,18)7-11(12)15/h1-3,6,11-12H,4-5,7-8H2 |
| InChIKey | FVWXAVZTTIJMPK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |