C16H20ClNO4S — CID 110629070
4-(3-chlorophenyl)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)butan-1-one (PubChem CID 110629070) has the molecular formula C16H20ClNO4S and a molecular weight of 357.86 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)butan-1-one.
| Compound Name | 4-(3-chlorophenyl)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)butan-1-one |
|---|---|
| PubChem CID | 110629070 |
| Molecular Formula | C16H20ClNO4S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 4-(3-chlorophenyl)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)butan-1-one |
| SMILES | O=C(CCCc1cccc(Cl)c1)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C16H20ClNO4S/c17-13-5-1-3-12(9-13)4-2-6-16(19)18-7-8-22-15-11-23(20,21)10-14(15)18/h1,3,5,9,14-15H,2,4,6-8,10-11H2 |
| InChIKey | CGFKAHGPARGTKX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |