C18H24FNO4S — CID 110354433
1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-(4-fluorophenyl)hexan-1-one (PubChem CID 110354433) has the molecular formula C18H24FNO4S and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-(4-fluorophenyl)hexan-1-one.
| Compound Name | 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-(4-fluorophenyl)hexan-1-one |
|---|---|
| PubChem CID | 110354433 |
| Molecular Formula | C18H24FNO4S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-3-(4-fluorophenyl)hexan-1-one |
| SMILES | CCCC(CC(=O)N1CCOC2CS(=O)(=O)CC21)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNO4S/c1-2-3-14(13-4-6-15(19)7-5-13)10-18(21)20-8-9-24-17-12-25(22,23)11-16(17)20/h4-7,14,16-17H,2-3,8-12H2,1H3 |
| InChIKey | LSNHTTVTTYQCBL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |