C14H16BrNO5S — CID 110629009
(5-bromo-2-methoxyphenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone (PubChem CID 110629009) has the molecular formula C14H16BrNO5S and a molecular weight of 390.26 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone.
| Compound Name | (5-bromo-2-methoxyphenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone |
|---|---|
| PubChem CID | 110629009 |
| Molecular Formula | C14H16BrNO5S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)methanone |
| SMILES | COc1ccc(Br)cc1C(=O)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C14H16BrNO5S/c1-20-12-3-2-9(15)6-10(12)14(17)16-4-5-21-13-8-22(18,19)7-11(13)16/h2-3,6,11,13H,4-5,7-8H2,1H3 |
| InChIKey | KRNJTAOUSMTIPS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |