C14H15BrINO2 — CID 113227342
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(5-bromo-2-iodophenyl)methanone (PubChem CID 113227342) has the molecular formula C14H15BrINO2 and a molecular weight of 436.09 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(5-bromo-2-iodophenyl)methanone.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(5-bromo-2-iodophenyl)methanone |
|---|---|
| PubChem CID | 113227342 |
| Molecular Formula | C14H15BrINO2 |
| Molecular Weight | 436.09 g/mol |
| Exact Mass | 434.93 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(5-bromo-2-iodophenyl)methanone |
| SMILES | O=C(c1cc(Br)ccc1I)N1CCOC2CCCC21 |
| InChI | InChI=1S/C14H15BrINO2/c15-9-4-5-11(16)10(8-9)14(18)17-6-7-19-13-3-1-2-12(13)17/h4-5,8,12-13H,1-3,6-7H2 |
| InChIKey | DNZRNQOBMGSFQB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|