C15H13BrINOS — CID 103600262
(5-bromo-2-iodophenyl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone (PubChem CID 103600262) has the molecular formula C15H13BrINOS and a molecular weight of 462.15 g/mol. Its IUPAC name is (5-bromo-2-iodophenyl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | (5-bromo-2-iodophenyl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103600262 |
| Molecular Formula | C15H13BrINOS |
| Molecular Weight | 462.15 g/mol |
| Exact Mass | 460.89 |
| IUPAC Name | (5-bromo-2-iodophenyl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(Br)ccc1I)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C15H13BrINOS/c16-10-5-6-12(17)11(9-10)15(19)18-7-1-3-13(18)14-4-2-8-20-14/h2,4-6,8-9,13H,1,3,7H2 |
| InChIKey | MHSQYHPGCXVAEJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|