C13H12ClNO2S — CID 30545695
(5-chlorofuran-2-yl)-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methanone (PubChem CID 30545695) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | (5-chlorofuran-2-yl)-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 30545695 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | (5-chlorofuran-2-yl)-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)o1)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C13H12ClNO2S/c14-12-6-5-10(17-12)13(16)15-7-1-3-9(15)11-4-2-8-18-11/h2,4-6,8-9H,1,3,7H2/t9-/m0/s1 |
| InChIKey | IKXNCFOTPKBQNR-VIFPVBQESA-N |
| XLogP | 3.97 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |