C17H14ClNOS2 — CID 30035571
(3-chloro-1-benzothiophen-2-yl)-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methanone (PubChem CID 30035571) has the molecular formula C17H14ClNOS2 and a molecular weight of 347.89 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 30035571 |
| Molecular Formula | C17H14ClNOS2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1sc2ccccc2c1Cl)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C17H14ClNOS2/c18-15-11-5-1-2-7-13(11)22-16(15)17(20)19-9-3-6-12(19)14-8-4-10-21-14/h1-2,4-5,7-8,10,12H,3,6,9H2/t12-/m1/s1 |
| InChIKey | RJOCPYCDLDMTCQ-GFCCVEGCSA-N |
| XLogP | 5.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |