C18H16ClNO2S — CID 43018641
(5-chloro-3-methyl-1-benzofuran-2-yl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone (PubChem CID 43018641) has the molecular formula C18H16ClNO2S and a molecular weight of 345.85 g/mol. Its IUPAC name is (5-chloro-3-methyl-1-benzofuran-2-yl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | (5-chloro-3-methyl-1-benzofuran-2-yl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 43018641 |
| Molecular Formula | C18H16ClNO2S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (5-chloro-3-methyl-1-benzofuran-2-yl)-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCCC2c2cccs2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H16ClNO2S/c1-11-13-10-12(19)6-7-15(13)22-17(11)18(21)20-8-2-4-14(20)16-5-3-9-23-16/h3,5-7,9-10,14H,2,4,8H2,1H3 |
| InChIKey | RDOREAMOQCKUGA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |