C15H14ClNO4 — CID 78919943
(2R)-1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 78919943) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is (2R)-1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 78919943 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (2R)-1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CCC[C@@H]2C(=O)O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H14ClNO4/c1-8-10-7-9(16)4-5-12(10)21-13(8)14(18)17-6-2-3-11(17)15(19)20/h4-5,7,11H,2-3,6H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | IBNDNRPWLKPKGH-LLVKDONJSA-N |
| XLogP | 3.08 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |