C20H22ClNO4 — CID 55514009
methyl 1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55514009) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is methyl 1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55514009 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | methyl 1-(5-chloro-3-methyl-1-benzofuran-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)c1oc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C20H22ClNO4/c1-11-14-10-13(21)7-8-17(14)26-18(11)19(23)22-15-6-4-3-5-12(15)9-16(22)20(24)25-2/h7-8,10,12,15-16H,3-6,9H2,1-2H3 |
| InChIKey | GGGZIBAVMWRXHQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |