C23H25ClN2O4S — CID 55870701
methyl 1-[5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55870701) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is methyl 1-[5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55870701 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | methyl 1-[5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)c1sc(NC(=O)c2ccccc2Cl)cc1C |
| InChI | InChI=1S/C23H25ClN2O4S/c1-13-11-19(25-21(27)15-8-4-5-9-16(15)24)31-20(13)22(28)26-17-10-6-3-7-14(17)12-18(26)23(29)30-2/h4-5,8-9,11,14,17-18H,3,6-7,10,12H2,1-2H3,(H,25,27) |
| InChIKey | NOAUBHWQKUQNQO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |