C23H27N3O5S — CID 55645459
methyl 2-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55645459) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is methyl 2-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55645459 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | methyl 2-[[1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)C2CC3CCCCC3N2C(=O)c2ccccc2OC)nc1C |
| InChI | InChI=1S/C23H27N3O5S/c1-13-19(22(29)31-3)32-23(24-13)25-20(27)17-12-14-8-4-6-10-16(14)26(17)21(28)15-9-5-7-11-18(15)30-2/h5,7,9,11,14,16-17H,4,6,8,10,12H2,1-3H3,(H,24,25,27) |
| InChIKey | ZJWXMWZFHWKOPI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |