C28H35N3O4 — CID 55645419
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 55645419) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 55645419 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-(2-methoxybenzoyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COc1ccccc1C(=O)N1C(C(=O)N(C)CC(=O)Nc2c(C)cccc2C)CC2CCCCC21 |
| InChI | InChI=1S/C28H35N3O4/c1-18-10-9-11-19(2)26(18)29-25(32)17-30(3)28(34)23-16-20-12-5-7-14-22(20)31(23)27(33)21-13-6-8-15-24(21)35-4/h6,8-11,13,15,20,22-23H,5,7,12,14,16-17H2,1-4H3,(H,29,32) |
| InChIKey | PIUUEBMWUBEGLP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |