C24H34N2O3 — CID 98785907
(2S,3aR,7aS)-1-(2-methoxybenzoyl)-N-[(1R,2S)-2-methylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 98785907) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-(2-methoxybenzoyl)-N-[(1R,2S)-2-methylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aR,7aS)-1-(2-methoxybenzoyl)-N-[(1R,2S)-2-methylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 98785907 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (2S,3aR,7aS)-1-(2-methoxybenzoyl)-N-[(1R,2S)-2-methylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COc1ccccc1C(=O)N1[C@H](C(=O)N[C@@H]2CCCC[C@@H]2C)C[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C24H34N2O3/c1-16-9-3-6-12-19(16)25-23(27)21-15-17-10-4-7-13-20(17)26(21)24(28)18-11-5-8-14-22(18)29-2/h5,8,11,14,16-17,19-21H,3-4,6-7,9-10,12-13,15H2,1-2H3,(H,25,27)/t16-,17+,19+,20-,21-/m0/s1 |
| InChIKey | PFEAOGPSDOLYCY-TYIUSFPZSA-N |
| XLogP | 4.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |