C25H29FN2O4 — CID 55676479
N-[2-(3-fluorophenoxy)ethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 55676479) has the molecular formula C25H29FN2O4 and a molecular weight of 440.52 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 55676479 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-1-(2-methoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COc1ccccc1C(=O)N1C(C(=O)NCCOc2cccc(F)c2)CC2CCCCC21 |
| InChI | InChI=1S/C25H29FN2O4/c1-31-23-12-5-3-10-20(23)25(30)28-21-11-4-2-7-17(21)15-22(28)24(29)27-13-14-32-19-9-6-8-18(26)16-19/h3,5-6,8-10,12,16-17,21-22H,2,4,7,11,13-15H2,1H3,(H,27,29) |
| InChIKey | ZYWSIUQSPOUSAW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|