C24H28N2O3 — CID 55645577
1-(2-methoxybenzoyl)-N-methyl-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 55645577) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-(2-methoxybenzoyl)-N-methyl-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-(2-methoxybenzoyl)-N-methyl-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 55645577 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-(2-methoxybenzoyl)-N-methyl-N-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COc1ccccc1C(=O)N1C(C(=O)N(C)c2ccccc2)CC2CCCCC21 |
| InChI | InChI=1S/C24H28N2O3/c1-25(18-11-4-3-5-12-18)24(28)21-16-17-10-6-8-14-20(17)26(21)23(27)19-13-7-9-15-22(19)29-2/h3-5,7,9,11-13,15,17,20-21H,6,8,10,14,16H2,1-2H3 |
| InChIKey | WSRFECDWFCVEMP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |